C19H15N3O4 — CID 11674682
methyl 4-(3-cyano-6,7-dimethyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)benzoate (PubChem CID 11674682) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is methyl 4-(3-cyano-6,7-dimethyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)benzoate.
| Compound Name | methyl 4-(3-cyano-6,7-dimethyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)benzoate |
|---|---|
| PubChem CID | 11674682 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl 4-(3-cyano-6,7-dimethyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2c(C#N)[n+](=O)c3cc(C)c(C)cc3n2[O-])cc1 |
| InChI | InChI=1S/C19H15N3O4/c1-11-8-15-16(9-12(11)2)22(25)18(17(10-20)21(15)24)13-4-6-14(7-5-13)19(23)26-3/h4-9H,1-3H3 |
| InChIKey | DWXOYSAILRYDCW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|