C20H36O5Si — CID 11675385
2-[(1R,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-hydroxyhexyl]-5-oxocyclohex-3-en-1-yl]acetic acid (PubChem CID 11675385) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is 2-[(1R,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-hydroxyhexyl]-5-oxocyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-hydroxyhexyl]-5-oxocyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 11675385 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[(1R,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-hydroxyhexyl]-5-oxocyclohex-3-en-1-yl]acetic acid |
| SMILES | C[C@H](O)CCCC[C@H]1C(=O)C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C20H36O5Si/c1-14(21)9-7-8-10-15-16(13-19(23)24)18(12-11-17(15)22)25-26(5,6)20(2,3)4/h11-12,14-16,18,21H,7-10,13H2,1-6H3,(H,23,24)/t14-,15+,16+,18-/m0/s1 |
| InChIKey | AHFQXAMRZOSNDO-LHHMISFZSA-N |
| XLogP | 4.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|