C20H34O4Si — CID 11494355
(4S,8aR,12S,12aR)-12-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecine-2,9-dione (PubChem CID 11494355) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (4S,8aR,12S,12aR)-12-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecine-2,9-dione.
| Compound Name | (4S,8aR,12S,12aR)-12-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecine-2,9-dione |
|---|---|
| PubChem CID | 11494355 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (4S,8aR,12S,12aR)-12-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5,6,7,8,8a,12,12a-octahydro-1H-3-benzoxecine-2,9-dione |
| SMILES | C[C@H]1CCCC[C@H]2C(=O)C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC(=O)O1 |
| InChI | InChI=1S/C20H34O4Si/c1-14-9-7-8-10-15-16(13-19(22)23-14)18(12-11-17(15)21)24-25(5,6)20(2,3)4/h11-12,14-16,18H,7-10,13H2,1-6H3/t14-,15+,16+,18-/m0/s1 |
| InChIKey | RDXMPAHGVCECIU-LHHMISFZSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|