C22H19F7 — CID 11676033
2-[(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-phenylmethylidene]adamantane (PubChem CID 11676033) has the molecular formula C22H19F7 and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-[(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-phenylmethylidene]adamantane.
| Compound Name | 2-[(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-phenylmethylidene]adamantane |
|---|---|
| PubChem CID | 11676033 |
| Molecular Formula | C22H19F7 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-phenylmethylidene]adamantane |
| SMILES | FC1=C(C(=C2C3CC4CC(C3)CC2C4)c2ccccc2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C22H19F7/c23-19-18(20(24,25)22(28,29)21(19,26)27)17(13-4-2-1-3-5-13)16-14-7-11-6-12(9-14)10-15(16)8-11/h1-5,11-12,14-15H,6-10H2/b17-16- |
| InChIKey | KUORVWHWDVCHJF-MSUUIHNZSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|