C38H40O10 — CID 11679092
2-[(3,4-dimethoxyphenyl)methyl]-2-[[2-[(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenyl]methyl]-5,6-dimethoxyindene-1,3-dione (PubChem CID 11679092) has the molecular formula C38H40O10 and a molecular weight of 656.73 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-2-[[2-[(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenyl]methyl]-5,6-dimethoxyindene-1,3-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-2-[[2-[(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenyl]methyl]-5,6-dimethoxyindene-1,3-dione |
|---|---|
| PubChem CID | 11679092 |
| Molecular Formula | C38H40O10 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-2-[[2-[(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenyl]methyl]-5,6-dimethoxyindene-1,3-dione |
| SMILES | COc1ccc(Cc2cc(OC)c(OC)cc2CC2(Cc3ccc(OC)c(OC)c3)C(=O)c3cc(OC)c(OC)cc3C2=O)cc1OC |
| InChI | InChI=1S/C38H40O10/c1-41-28-11-9-22(14-30(28)43-3)13-24-16-32(45-5)33(46-6)17-25(24)21-38(20-23-10-12-29(42-2)31(15-23)44-4)36(39)26-18-34(47-7)35(48-8)19-27(26)37(38)40/h9-12,14-19H,13,20-21H2,1-8H3 |
| InChIKey | FGILDZAFTKIEPV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|