C10H8Cl2N4O2S — CID 116794709
2-amino-6-chloro-N-(2-chloropyrimidin-4-yl)benzenesulfonamide (PubChem CID 116794709) has the molecular formula C10H8Cl2N4O2S and a molecular weight of 319.17 g/mol. Its IUPAC name is 2-amino-6-chloro-N-(2-chloropyrimidin-4-yl)benzenesulfonamide.
| Compound Name | 2-amino-6-chloro-N-(2-chloropyrimidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116794709 |
| Molecular Formula | C10H8Cl2N4O2S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 2-amino-6-chloro-N-(2-chloropyrimidin-4-yl)benzenesulfonamide |
| SMILES | Nc1cccc(Cl)c1S(=O)(=O)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N4O2S/c11-6-2-1-3-7(13)9(6)19(17,18)16-8-4-5-14-10(12)15-8/h1-5H,13H2,(H,14,15,16) |
| InChIKey | HAIFYWUXAYICHY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|