About azanium chlorate
azanium chlorate (PubChem CID 11679808) has the molecular formula H4ClNO3
and a molecular weight of 101.49 g/mol. Its IUPAC name is azanium chlorate.
Molecular Properties
| Compound Name | azanium chlorate |
| PubChem CID | 11679808 |
| Molecular Formula | H4ClNO3 |
| Molecular Weight | 101.49 g/mol |
| Exact Mass | 100.99 |
| IUPAC Name | azanium chlorate |
| SMILES | [NH4+].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/ClO3.H3N/c2-1(3)4;/h;1H3/q-1;/p+1 |
| InChIKey | IYVRKTMIWIXBBO-UHFFFAOYSA-O |
| XLogP | -3.19 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.49 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium chlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium chlorate?
The IUPAC name of azanium chlorate (CID 11679808) is azanium chlorate.
What is the SMILES notation for azanium chlorate?
The canonical SMILES for azanium chlorate is [NH4+].[O-][Cl+2]([O-])[O-].
What is the InChIKey of azanium chlorate?
The InChIKey is IYVRKTMIWIXBBO-UHFFFAOYSA-O. The full InChI is InChI=1S/ClO3.H3N/c2-1(3)4;/h;1H3/q-1;/p+1.
What are the key properties of azanium chlorate?
azanium chlorate has a molecular weight of 101.49 g/mol, XLogP of -3.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium chlorate is sourced from PubChem (CID 11679808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).