About lithium;chlorate;hydrate
lithium;chlorate;hydrate (PubChem CID 23666904) has the molecular formula H2ClLiO4
and a molecular weight of 108.41 g/mol. Its IUPAC name is lithium;chlorate;hydrate.
Molecular Properties
| Compound Name | lithium;chlorate;hydrate |
| PubChem CID | 23666904 |
| Molecular Formula | H2ClLiO4 |
| Molecular Weight | 108.41 g/mol |
| Exact Mass | 107.98 |
| IUPAC Name | lithium;chlorate;hydrate |
| SMILES | O.[Li+].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/ClO3.Li.H2O/c2-1(3)4;;/h;;1H2/q-1;+1; |
| InChIKey | KSQVTCRFCWMPNL-UHFFFAOYSA-N |
| XLogP | -7.39 |
| TPSA | 100.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.41 |
| LogP ≤ 5 | -7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;chlorate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;chlorate;hydrate?
The IUPAC name of lithium;chlorate;hydrate (CID 23666904) is lithium;chlorate;hydrate.
What is the SMILES notation for lithium;chlorate;hydrate?
The canonical SMILES for lithium;chlorate;hydrate is O.[Li+].[O-][Cl+2]([O-])[O-].
What is the InChIKey of lithium;chlorate;hydrate?
The InChIKey is KSQVTCRFCWMPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/ClO3.Li.H2O/c2-1(3)4;;/h;;1H2/q-1;+1;.
What are the key properties of lithium;chlorate;hydrate?
lithium;chlorate;hydrate has a molecular weight of 108.41 g/mol, XLogP of -7.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;chlorate;hydrate is sourced from PubChem (CID 23666904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).