About potassium;zirconium(2+);chlorate
potassium;zirconium(2+);chlorate (PubChem CID 23717580) has the molecular formula ClKO3Zr+2
and a molecular weight of 213.77 g/mol. Its IUPAC name is potassium;zirconium(2+);chlorate.
Molecular Properties
| Compound Name | potassium;zirconium(2+);chlorate |
| PubChem CID | 23717580 |
| Molecular Formula | ClKO3Zr+2 |
| Molecular Weight | 213.77 g/mol |
| Exact Mass | 211.82 |
| IUPAC Name | potassium;zirconium(2+);chlorate |
| SMILES | [K+].[O-][Cl+2]([O-])[O-].[Zr+2] |
| InChI | InChI=1S/ClO3.K.Zr/c2-1(3)4;;/q-1;+1;+2 |
| InChIKey | XKBYRENZFJREDI-UHFFFAOYSA-N |
| XLogP | -6.57 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.77 |
| LogP ≤ 5 | -6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;zirconium(2+);chlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;zirconium(2+);chlorate?
The IUPAC name of potassium;zirconium(2+);chlorate (CID 23717580) is potassium;zirconium(2+);chlorate.
What is the SMILES notation for potassium;zirconium(2+);chlorate?
The canonical SMILES for potassium;zirconium(2+);chlorate is [K+].[O-][Cl+2]([O-])[O-].[Zr+2].
What is the InChIKey of potassium;zirconium(2+);chlorate?
The InChIKey is XKBYRENZFJREDI-UHFFFAOYSA-N. The full InChI is InChI=1S/ClO3.K.Zr/c2-1(3)4;;/q-1;+1;+2.
What are the key properties of potassium;zirconium(2+);chlorate?
potassium;zirconium(2+);chlorate has a molecular weight of 213.77 g/mol, XLogP of -6.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;zirconium(2+);chlorate is sourced from PubChem (CID 23717580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).