About zinc dichlorate
zinc dichlorate (PubChem CID 25206) has the molecular formula Cl2O6Zn
and a molecular weight of 232.29 g/mol. Its IUPAC name is zinc dichlorate.
Molecular Properties
| Compound Name | zinc dichlorate |
| PubChem CID | 25206 |
| Molecular Formula | Cl2O6Zn |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 229.84 |
| IUPAC Name | zinc dichlorate |
| SMILES | [O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-].[Zn+2] |
| InChI | InChI=1S/2ClO3.Zn/c2*2-1(3)4;/q2*-1;+2 |
| InChIKey | VPKDXSUVRVLYOV-UHFFFAOYSA-N |
| XLogP | -7.14 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | -7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc dichlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc dichlorate?
The IUPAC name of zinc dichlorate (CID 25206) is zinc dichlorate.
What is the SMILES notation for zinc dichlorate?
The canonical SMILES for zinc dichlorate is [O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-].[Zn+2].
What is the InChIKey of zinc dichlorate?
The InChIKey is VPKDXSUVRVLYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClO3.Zn/c2*2-1(3)4;/q2*-1;+2.
What are the key properties of zinc dichlorate?
zinc dichlorate has a molecular weight of 232.29 g/mol, XLogP of -7.14, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc dichlorate is sourced from PubChem (CID 25206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).