About manganese(2+) dichlorate
manganese(2+) dichlorate (PubChem CID 24983783) has the molecular formula Cl2MnO6
and a molecular weight of 221.84 g/mol. Its IUPAC name is manganese(2+) dichlorate.
Molecular Properties
| Compound Name | manganese(2+) dichlorate |
| PubChem CID | 24983783 |
| Molecular Formula | Cl2MnO6 |
| Molecular Weight | 221.84 g/mol |
| Exact Mass | 220.85 |
| IUPAC Name | manganese(2+) dichlorate |
| SMILES | [Mn+2].[O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/2ClO3.Mn/c2*2-1(3)4;/q2*-1;+2 |
| InChIKey | BAIVKEBZBUSZIY-UHFFFAOYSA-N |
| XLogP | -7.14 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.84 |
| LogP ≤ 5 | -7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze manganese(2+) dichlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+) dichlorate?
The IUPAC name of manganese(2+) dichlorate (CID 24983783) is manganese(2+) dichlorate.
What is the SMILES notation for manganese(2+) dichlorate?
The canonical SMILES for manganese(2+) dichlorate is [Mn+2].[O-][Cl+2]([O-])[O-].[O-][Cl+2]([O-])[O-].
What is the InChIKey of manganese(2+) dichlorate?
The InChIKey is BAIVKEBZBUSZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClO3.Mn/c2*2-1(3)4;/q2*-1;+2.
What are the key properties of manganese(2+) dichlorate?
manganese(2+) dichlorate has a molecular weight of 221.84 g/mol, XLogP of -7.14, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+) dichlorate is sourced from PubChem (CID 24983783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).