C11H11F2NO — CID 116841453
6-(1,1-difluoro-2-methylpropyl)-1,3-benzoxazole (PubChem CID 116841453) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 6-(1,1-difluoro-2-methylpropyl)-1,3-benzoxazole.
| Compound Name | 6-(1,1-difluoro-2-methylpropyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 116841453 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-(1,1-difluoro-2-methylpropyl)-1,3-benzoxazole |
| SMILES | CC(C)C(F)(F)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H11F2NO/c1-7(2)11(12,13)8-3-4-9-10(5-8)15-6-14-9/h3-7H,1-2H3 |
| InChIKey | IRWICSWSCBNZRU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |