C14H19ClO2 — CID 116864133
3-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2,2-dimethyloxirane (PubChem CID 116864133) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2,2-dimethyloxirane.
| Compound Name | 3-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 116864133 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2,2-dimethyloxirane |
| SMILES | COc1c(C)c(C)c(Cl)c(C)c1C1OC1(C)C |
| InChI | InChI=1S/C14H19ClO2/c1-7-8(2)12(16-6)10(9(3)11(7)15)13-14(4,5)17-13/h13H,1-6H3 |
| InChIKey | MDHSINHBGJCIAY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|