C12H14N2O3 — CID 116872667
6-(3-aminooxetan-3-yl)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 116872667) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 6-(3-aminooxetan-3-yl)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-aminooxetan-3-yl)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116872667 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6-(3-aminooxetan-3-yl)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(C3(N)COC3)cc21 |
| InChI | InChI=1S/C12H14N2O3/c1-14-9-4-8(12(13)6-16-7-12)2-3-10(9)17-5-11(14)15/h2-4H,5-7,13H2,1H3 |
| InChIKey | MAJLJWWVUBKTRV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |