C12H13NO3S — CID 116872893
4-methyl-6-(3-sulfanyloxetan-3-yl)-1,4-benzoxazin-3-one (PubChem CID 116872893) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-methyl-6-(3-sulfanyloxetan-3-yl)-1,4-benzoxazin-3-one.
| Compound Name | 4-methyl-6-(3-sulfanyloxetan-3-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116872893 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-methyl-6-(3-sulfanyloxetan-3-yl)-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(C3(S)COC3)cc21 |
| InChI | InChI=1S/C12H13NO3S/c1-13-9-4-8(12(17)6-15-7-12)2-3-10(9)16-5-11(13)14/h2-4,17H,5-7H2,1H3 |
| InChIKey | CNBOZTCMQSLGEI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|