C16H11FN2O — CID 11687602
2-[4-(5-fluoro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole (PubChem CID 11687602) has the molecular formula C16H11FN2O and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-[4-(5-fluoro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole.
| Compound Name | 2-[4-(5-fluoro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 11687602 |
| Molecular Formula | C16H11FN2O |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[4-(5-fluoro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole |
| SMILES | Fc1ccc(C#CCCc2nc3ccccc3o2)nc1 |
| InChI | InChI=1S/C16H11FN2O/c17-12-9-10-13(18-11-12)5-1-4-8-16-19-14-6-2-3-7-15(14)20-16/h2-3,6-7,9-11H,4,8H2 |
| InChIKey | ATEPRWDSDGACGX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|