C12H15F2O6P — CID 11688401
1-dimethoxyphosphorylethyl 2-(2,4-difluorophenoxy)acetate (PubChem CID 11688401) has the molecular formula C12H15F2O6P and a molecular weight of 324.22 g/mol. Its IUPAC name is 1-dimethoxyphosphorylethyl 2-(2,4-difluorophenoxy)acetate.
| Compound Name | 1-dimethoxyphosphorylethyl 2-(2,4-difluorophenoxy)acetate |
|---|---|
| PubChem CID | 11688401 |
| Molecular Formula | C12H15F2O6P |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-dimethoxyphosphorylethyl 2-(2,4-difluorophenoxy)acetate |
| SMILES | COP(=O)(OC)C(C)OC(=O)COc1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2O6P/c1-8(21(16,17-2)18-3)20-12(15)7-19-11-5-4-9(13)6-10(11)14/h4-6,8H,7H2,1-3H3 |
| InChIKey | JLKWVZVEDXWTOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|