C24H36O4 — CID 11689621
(2R,6R,7R,8S,11S,12E,14R)-11-(methoxymethyl)-4,4,7,14-tetramethyl-17-propan-2-yl-3,5-dioxatetracyclo[12.3.0.02,6.08,12]heptadeca-1(17),12-dien-15-one (PubChem CID 11689621) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (2R,6R,7R,8S,11S,12E,14R)-11-(methoxymethyl)-4,4,7,14-tetramethyl-17-propan-2-yl-3,5-dioxatetracyclo[12.3.0.02,6.08,12]heptadeca-1(17),12-dien-15-one.
| Compound Name | (2R,6R,7R,8S,11S,12E,14R)-11-(methoxymethyl)-4,4,7,14-tetramethyl-17-propan-2-yl-3,5-dioxatetracyclo[12.3.0.02,6.08,12]heptadeca-1(17),12-dien-15-one |
|---|---|
| PubChem CID | 11689621 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (2R,6R,7R,8S,11S,12E,14R)-11-(methoxymethyl)-4,4,7,14-tetramethyl-17-propan-2-yl-3,5-dioxatetracyclo[12.3.0.02,6.08,12]heptadeca-1(17),12-dien-15-one |
| SMILES | COC[C@H]1CC[C@@H]2/C1=C\[C@@]1(C)C(=O)CC(C(C)C)=C1[C@H]1OC(C)(C)O[C@@H]1[C@@H]2C |
| InChI | InChI=1S/C24H36O4/c1-13(2)17-10-19(25)24(6)11-18-15(12-26-7)8-9-16(18)14(3)21-22(20(17)24)28-23(4,5)27-21/h11,13-16,21-22H,8-10,12H2,1-7H3/b18-11-/t14-,15-,16+,21-,22-,24+/m1/s1 |
| InChIKey | IAHRZROQAPXNTM-MOYSUEKGSA-N |
| XLogP | 4.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|