C27H26Cl2N2O2 — CID 11691513
N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]naphthalen-1-yl]-2,4-dichlorobenzamide (PubChem CID 11691513) has the molecular formula C27H26Cl2N2O2 and a molecular weight of 481.42 g/mol. Its IUPAC name is N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]naphthalen-1-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]naphthalen-1-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 11691513 |
| Molecular Formula | C27H26Cl2N2O2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]naphthalen-1-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCC[C@H]3CCCC[C@@H]32)c2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H26Cl2N2O2/c28-18-11-12-22(23(29)16-18)26(32)30-24-14-13-21(19-8-2-3-9-20(19)24)27(33)31-15-5-7-17-6-1-4-10-25(17)31/h2-3,8-9,11-14,16-17,25H,1,4-7,10,15H2,(H,30,32)/t17-,25+/m1/s1 |
| InChIKey | QMBZNVLZQIXDRZ-NSYGIPOTSA-N |
| XLogP | 7.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |