C28H29FN2O2 — CID 58708067
4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-N-[(2-fluorophenyl)methyl]naphthalene-1-carboxamide (PubChem CID 58708067) has the molecular formula C28H29FN2O2 and a molecular weight of 444.55 g/mol. Its IUPAC name is 4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-N-[(2-fluorophenyl)methyl]naphthalene-1-carboxamide.
| Compound Name | 4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-N-[(2-fluorophenyl)methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 58708067 |
| Molecular Formula | C28H29FN2O2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-N-[(2-fluorophenyl)methyl]naphthalene-1-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc(C(=O)N2CCC[C@@H]3CCCC[C@@H]32)c2ccccc12 |
| InChI | InChI=1S/C28H29FN2O2/c29-25-13-5-1-9-20(25)18-30-27(32)23-15-16-24(22-12-4-3-11-21(22)23)28(33)31-17-7-10-19-8-2-6-14-26(19)31/h1,3-5,9,11-13,15-16,19,26H,2,6-8,10,14,17-18H2,(H,30,32)/t19-,26-/m0/s1 |
| InChIKey | LANLQEMKTKWPSM-SIBVEZHUSA-N |
| XLogP | 5.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |