C15H10N2O5 — CID 11695086
9-nitro-3,6-dihydro-2H-[1,4]dioxino[2,3-b]acridin-11-one (PubChem CID 11695086) has the molecular formula C15H10N2O5 and a molecular weight of 298.25 g/mol. Its IUPAC name is 9-nitro-3,6-dihydro-2H-[1,4]dioxino[2,3-b]acridin-11-one.
| Compound Name | 9-nitro-3,6-dihydro-2H-[1,4]dioxino[2,3-b]acridin-11-one |
|---|---|
| PubChem CID | 11695086 |
| Molecular Formula | C15H10N2O5 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 9-nitro-3,6-dihydro-2H-[1,4]dioxino[2,3-b]acridin-11-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2[nH]c2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C15H10N2O5/c18-15-9-5-8(17(19)20)1-2-11(9)16-12-7-14-13(6-10(12)15)21-3-4-22-14/h1-2,5-7H,3-4H2,(H,16,18) |
| InChIKey | UQOMZWUHMNWIMG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|