C14H15NO2 — CID 116963374
4-(2-methyl-1,3-benzoxazol-6-yl)cyclohexan-1-one (PubChem CID 116963374) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(2-methyl-1,3-benzoxazol-6-yl)cyclohexan-1-one.
| Compound Name | 4-(2-methyl-1,3-benzoxazol-6-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 116963374 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-(2-methyl-1,3-benzoxazol-6-yl)cyclohexan-1-one |
| SMILES | Cc1nc2ccc(C3CCC(=O)CC3)cc2o1 |
| InChI | InChI=1S/C14H15NO2/c1-9-15-13-7-4-11(8-14(13)17-9)10-2-5-12(16)6-3-10/h4,7-8,10H,2-3,5-6H2,1H3 |
| InChIKey | WYTFDWJVHOCYSH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |