C12H15N3OS — CID 116994141
6-(morpholin-3-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 116994141) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 6-(morpholin-3-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(morpholin-3-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 116994141 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 6-(morpholin-3-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(CC3COCCN3)cc2s1 |
| InChI | InChI=1S/C12H15N3OS/c13-12-15-10-2-1-8(6-11(10)17-12)5-9-7-16-4-3-14-9/h1-2,6,9,14H,3-5,7H2,(H2,13,15) |
| InChIKey | QWBLAYIOODFXQR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |