C15H21NO — CID 116996378
2-(2,3-dimethyl-1H-indol-5-yl)-3-methylbutan-1-ol (PubChem CID 116996378) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-indol-5-yl)-3-methylbutan-1-ol.
| Compound Name | 2-(2,3-dimethyl-1H-indol-5-yl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 116996378 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(2,3-dimethyl-1H-indol-5-yl)-3-methylbutan-1-ol |
| SMILES | Cc1[nH]c2ccc(C(CO)C(C)C)cc2c1C |
| InChI | InChI=1S/C15H21NO/c1-9(2)14(8-17)12-5-6-15-13(7-12)10(3)11(4)16-15/h5-7,9,14,16-17H,8H2,1-4H3 |
| InChIKey | KLXQRJOTZUPCOX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|