C14H20N2 — CID 116996491
2,2-dimethyl-3-(3-methyl-1H-indol-5-yl)propan-1-amine (PubChem CID 116996491) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-methyl-1H-indol-5-yl)propan-1-amine.
| Compound Name | 2,2-dimethyl-3-(3-methyl-1H-indol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 116996491 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,2-dimethyl-3-(3-methyl-1H-indol-5-yl)propan-1-amine |
| SMILES | Cc1c[nH]c2ccc(CC(C)(C)CN)cc12 |
| InChI | InChI=1S/C14H20N2/c1-10-8-16-13-5-4-11(6-12(10)13)7-14(2,3)9-15/h4-6,8,16H,7,9,15H2,1-3H3 |
| InChIKey | JBYUZQOWFGRVIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |