C16H22N2 — CID 82577007
3-(2,4-dimethylquinolin-6-yl)-2,2-dimethylpropan-1-amine (PubChem CID 82577007) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-(2,4-dimethylquinolin-6-yl)-2,2-dimethylpropan-1-amine.
| Compound Name | 3-(2,4-dimethylquinolin-6-yl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 82577007 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-(2,4-dimethylquinolin-6-yl)-2,2-dimethylpropan-1-amine |
| SMILES | Cc1cc(C)c2cc(CC(C)(C)CN)ccc2n1 |
| InChI | InChI=1S/C16H22N2/c1-11-7-12(2)18-15-6-5-13(8-14(11)15)9-16(3,4)10-17/h5-8H,9-10,17H2,1-4H3 |
| InChIKey | AVRPYRSOPASYIN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |