C34H50N4O4S2 — CID 11700203
N-[4-[3-[[4-(dimethylamino)phenyl]methylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 11700203) has the molecular formula C34H50N4O4S2 and a molecular weight of 642.93 g/mol. Its IUPAC name is N-[4-[3-[[4-(dimethylamino)phenyl]methylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-[3-[[4-(dimethylamino)phenyl]methylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 11700203 |
| Molecular Formula | C34H50N4O4S2 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | N-[4-[3-[[4-(dimethylamino)phenyl]methylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCCCN(CCCNCc2ccc(N(C)C)cc2)S(=O)(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C34H50N4O4S2/c1-25-20-27(3)33(28(4)21-25)43(39,40)36-17-9-10-18-38(44(41,42)34-29(5)22-26(2)23-30(34)6)19-11-16-35-24-31-12-14-32(15-13-31)37(7)8/h12-15,20-23,35-36H,9-11,16-19,24H2,1-8H3 |
| InChIKey | XUTIDKYFJQRGPD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|