C14H19N3 — CID 117021059
4-(5-amino-2,2-dimethylpiperidin-1-yl)benzonitrile (PubChem CID 117021059) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 4-(5-amino-2,2-dimethylpiperidin-1-yl)benzonitrile.
| Compound Name | 4-(5-amino-2,2-dimethylpiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 117021059 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 4-(5-amino-2,2-dimethylpiperidin-1-yl)benzonitrile |
| SMILES | CC1(C)CCC(N)CN1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N3/c1-14(2)8-7-12(16)10-17(14)13-5-3-11(9-15)4-6-13/h3-6,12H,7-8,10,16H2,1-2H3 |
| InChIKey | MPTMEZMNPBLMQX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |