C17H32O3Si — CID 11702366
ethyl (2E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhepta-2,6-dienoate (PubChem CID 11702366) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is ethyl (2E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhepta-2,6-dienoate.
| Compound Name | ethyl (2E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 11702366 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | ethyl (2E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhepta-2,6-dienoate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C17H32O3Si/c1-10-15(20-21(8,9)17(5,6)7)13(3)12-14(4)16(18)19-11-2/h10,12-13,15H,1,11H2,2-9H3/b14-12+/t13-,15-/m1/s1 |
| InChIKey | KOHMFJAIELBXAQ-CNNVDREISA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|