C14H19NO5S — CID 11702382
methyl 5-(3-ethoxy-3-oxopropanoyl)-2-(ethylamino)-4-methylthiophene-3-carboxylate (PubChem CID 11702382) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 5-(3-ethoxy-3-oxopropanoyl)-2-(ethylamino)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-(3-ethoxy-3-oxopropanoyl)-2-(ethylamino)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 11702382 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 5-(3-ethoxy-3-oxopropanoyl)-2-(ethylamino)-4-methylthiophene-3-carboxylate |
| SMILES | CCNc1sc(C(=O)CC(=O)OCC)c(C)c1C(=O)OC |
| InChI | InChI=1S/C14H19NO5S/c1-5-15-13-11(14(18)19-4)8(3)12(21-13)9(16)7-10(17)20-6-2/h15H,5-7H2,1-4H3 |
| InChIKey | HRVJZRXXEBXUOW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|