C18H22N2O3S — CID 132513749
methyl 4-(3-aminopropyl)-5-benzoyl-2-(ethylamino)thiophene-3-carboxylate (PubChem CID 132513749) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is methyl 4-(3-aminopropyl)-5-benzoyl-2-(ethylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(3-aminopropyl)-5-benzoyl-2-(ethylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 132513749 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 4-(3-aminopropyl)-5-benzoyl-2-(ethylamino)thiophene-3-carboxylate |
| SMILES | CCNc1sc(C(=O)c2ccccc2)c(CCCN)c1C(=O)OC |
| InChI | InChI=1S/C18H22N2O3S/c1-3-20-17-14(18(22)23-2)13(10-7-11-19)16(24-17)15(21)12-8-5-4-6-9-12/h4-6,8-9,20H,3,7,10-11,19H2,1-2H3 |
| InChIKey | DTHISUNVAXBXPK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |