C19H34O2Si — CID 11702539
1-[4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-1-ol (PubChem CID 11702539) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-1-ol.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 11702539 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]but-3-yn-1-ol |
| SMILES | C#CCC(O)C1C(=C)CC(O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-10-11-16(20)17-14(2)12-15(13-19(17,6)7)21-22(8,9)18(3,4)5/h1,15-17,20H,2,11-13H2,3-9H3 |
| InChIKey | LFAILRHZQQKSKX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|