C17H34O2Si — CID 11770990
2-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]ethanol (PubChem CID 11770990) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is 2-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]ethanol.
| Compound Name | 2-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]ethanol |
|---|---|
| PubChem CID | 11770990 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]ethanol |
| SMILES | C=C1CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H]1CCO |
| InChI | InChI=1S/C17H34O2Si/c1-13-9-10-15(17(5,6)14(13)11-12-18)19-20(7,8)16(2,3)4/h14-15,18H,1,9-12H2,2-8H3/t14-,15-/m0/s1 |
| InChIKey | MYIOYDAXSLXZSW-GJZGRUSLSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|