C21H42O2Si — CID 15356211
(3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-methyl-5-methylideneheptan-3-ol (PubChem CID 15356211) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is (3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-methyl-5-methylideneheptan-3-ol.
| Compound Name | (3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-methyl-5-methylideneheptan-3-ol |
|---|---|
| PubChem CID | 15356211 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-methyl-5-methylideneheptan-3-ol |
| SMILES | C=C(C[C@H](O)C(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C21H42O2Si/c1-16(2)20(22)14-17(3)19(18-12-10-9-11-13-18)15-23-24(7,8)21(4,5)6/h16,18-20,22H,3,9-15H2,1-2,4-8H3/t19-,20+/m1/s1 |
| InChIKey | DVOXPESUKARCHU-UXHICEINSA-N |
| XLogP | 6.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|