C14H14N2O2 — CID 117046648
3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-yloxy)benzaldehyde (PubChem CID 117046648) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-yloxy)benzaldehyde.
| Compound Name | 3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-yloxy)benzaldehyde |
|---|---|
| PubChem CID | 117046648 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-8-yloxy)benzaldehyde |
| SMILES | O=Cc1cccc(OC2CCCn3cncc32)c1 |
| InChI | InChI=1S/C14H14N2O2/c17-9-11-3-1-4-12(7-11)18-14-5-2-6-16-10-15-8-13(14)16/h1,3-4,7-10,14H,2,5-6H2 |
| InChIKey | QCMQTSDPKJNRBD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|