C10H20N2O2 — CID 117050387
3-(2,6-diazabicyclo[3.2.2]nonan-6-yl)propane-1,2-diol (PubChem CID 117050387) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-(2,6-diazabicyclo[3.2.2]nonan-6-yl)propane-1,2-diol.
| Compound Name | 3-(2,6-diazabicyclo[3.2.2]nonan-6-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 117050387 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-(2,6-diazabicyclo[3.2.2]nonan-6-yl)propane-1,2-diol |
| SMILES | OCC(O)CN1CC2CCC1CCN2 |
| InChI | InChI=1S/C10H20N2O2/c13-7-10(14)6-12-5-8-1-2-9(12)3-4-11-8/h8-11,13-14H,1-7H2 |
| InChIKey | IQRBHJAEDBKDJD-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |