C6H12N2O3 — CID 142680209
1-(2,3-dihydroxypropyl)aziridine-2-carboxamide (PubChem CID 142680209) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)aziridine-2-carboxamide.
| Compound Name | 1-(2,3-dihydroxypropyl)aziridine-2-carboxamide |
|---|---|
| PubChem CID | 142680209 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)aziridine-2-carboxamide |
| SMILES | NC(=O)C1CN1CC(O)CO |
| InChI | InChI=1S/C6H12N2O3/c7-6(11)5-2-8(5)1-4(10)3-9/h4-5,9-10H,1-3H2,(H2,7,11) |
| InChIKey | WYDLYZJVEAJDGD-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|