C9H11N3O4S — CID 117058955
(prop-1-en-2-ylamino) 2-sulfamoylpyridine-3-carboxylate (PubChem CID 117058955) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is (prop-1-en-2-ylamino) 2-sulfamoylpyridine-3-carboxylate.
| Compound Name | (prop-1-en-2-ylamino) 2-sulfamoylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 117058955 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (prop-1-en-2-ylamino) 2-sulfamoylpyridine-3-carboxylate |
| SMILES | C=C(C)NOC(=O)c1cccnc1S(N)(=O)=O |
| InChI | InChI=1S/C9H11N3O4S/c1-6(2)12-16-9(13)7-4-3-5-11-8(7)17(10,14)15/h3-5,12H,1H2,2H3,(H2,10,14,15) |
| InChIKey | FYEIIPNOMSYZBC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|