C10H8Cl2N4 — CID 117063790
5-(2,4-dichlorophenyl)-2-prop-2-enyltetrazole (PubChem CID 117063790) has the molecular formula C10H8Cl2N4 and a molecular weight of 255.11 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-prop-2-enyltetrazole.
| Compound Name | 5-(2,4-dichlorophenyl)-2-prop-2-enyltetrazole |
|---|---|
| PubChem CID | 117063790 |
| Molecular Formula | C10H8Cl2N4 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-prop-2-enyltetrazole |
| SMILES | C=CCn1nnc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N4/c1-2-5-16-14-10(13-15-16)8-4-3-7(11)6-9(8)12/h2-4,6H,1,5H2 |
| InChIKey | RZYMHINMEWCGIB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|