C8H16F3NO2S — CID 117063801
1,1,1-trifluoro-N-(5-methylhexan-2-yl)methanesulfonamide (PubChem CID 117063801) has the molecular formula C8H16F3NO2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(5-methylhexan-2-yl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(5-methylhexan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 117063801 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1,1,1-trifluoro-N-(5-methylhexan-2-yl)methanesulfonamide |
| SMILES | CC(C)CCC(C)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-6(2)4-5-7(3)12-15(13,14)8(9,10)11/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | YJOWLBBUTNSOQS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |