C12H18N4 — CID 117068759
1-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)-1-(2-phenylethyl)hydrazine (PubChem CID 117068759) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)-1-(2-phenylethyl)hydrazine.
| Compound Name | 1-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)-1-(2-phenylethyl)hydrazine |
|---|---|
| PubChem CID | 117068759 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)-1-(2-phenylethyl)hydrazine |
| SMILES | CC1CN=C(N(N)CCc2ccccc2)N1 |
| InChI | InChI=1S/C12H18N4/c1-10-9-14-12(15-10)16(13)8-7-11-5-3-2-4-6-11/h2-6,10H,7-9,13H2,1H3,(H,14,15) |
| InChIKey | FRSNIQWELLBQID-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|