C22H40O2Si — CID 117070480
(4aR,8R,8aS)-8-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-methyl-3,4,4a,7,8,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 117070480) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (4aR,8R,8aS)-8-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-methyl-3,4,4a,7,8,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (4aR,8R,8aS)-8-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-methyl-3,4,4a,7,8,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 117070480 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (4aR,8R,8aS)-8-[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-methyl-3,4,4a,7,8,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | CC1=C[C@@H]2CCC(=O)C[C@@H]2[C@H](C(CO[Si](C)(C)C(C)(C)C)C(C)C)C1 |
| InChI | InChI=1S/C22H40O2Si/c1-15(2)21(14-24-25(7,8)22(4,5)6)20-12-16(3)11-17-9-10-18(23)13-19(17)20/h11,15,17,19-21H,9-10,12-14H2,1-8H3/t17-,19-,20+,21?/m0/s1 |
| InChIKey | JLLMERMRIPANLJ-YBVXAUJNSA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|