C27H37NO6S — CID 117070899
(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-[(1R,3S,4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]methanone (PubChem CID 117070899) has the molecular formula C27H37NO6S and a molecular weight of 503.66 g/mol. Its IUPAC name is (10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-[(1R,3S,4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]methanone.
| Compound Name | (10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-[(1R,3S,4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]methanone |
|---|---|
| PubChem CID | 117070899 |
| Molecular Formula | C27H37NO6S |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-[(1R,3S,4S,6R)-6-[(4-methoxyphenyl)methoxymethyl]-4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]methanone |
| SMILES | COc1ccc(COC[C@]23C[C@H](C)[C@@H](C(=O)N4C5CC6CCC5(CS4(=O)=O)C6(C)C)C[C@H]2O3)cc1 |
| InChI | InChI=1S/C27H37NO6S/c1-17-13-27(15-33-14-18-5-7-20(32-4)8-6-18)23(34-27)12-21(17)24(29)28-22-11-19-9-10-26(22,25(19,2)3)16-35(28,30)31/h5-8,17,19,21-23H,9-16H2,1-4H3/t17-,19?,21-,22?,23+,26?,27+/m0/s1 |
| InChIKey | CZLKEQRDFYERTK-NPOPFBMGSA-N |
| XLogP | 3.76 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|