C26H37NO5S — CID 71615178
(3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-en-1-one (PubChem CID 71615178) has the molecular formula C26H37NO5S and a molecular weight of 475.65 g/mol. Its IUPAC name is (3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-en-1-one.
| Compound Name | (3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-en-1-one |
|---|---|
| PubChem CID | 71615178 |
| Molecular Formula | C26H37NO5S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-en-1-one |
| SMILES | C=C(COCc1ccc(OC)cc1)C[C@@H](C)CC(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C26H37NO5S/c1-18(12-19(2)15-32-16-20-6-8-22(31-5)9-7-20)13-24(28)27-23-14-21-10-11-26(23,25(21,3)4)17-33(27,29)30/h6-9,18,21,23H,2,10-17H2,1,3-5H3/t18-,21-,23-,26-/m1/s1 |
| InChIKey | BUNBSIBMJOJMDR-JJNNOHKVSA-N |
| XLogP | 4.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|