C19H33N9 — CID 117083842
6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 117083842) has the molecular formula C19H33N9 and a molecular weight of 387.54 g/mol. Its IUPAC name is 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117083842 |
| Molecular Formula | C19H33N9 |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCCN(C(C)C)C(C)C)nc(Nc2ccncn2)n1 |
| InChI | InChI=1S/C19H33N9/c1-7-27(8-2)19-25-17(21-11-12-28(14(3)4)15(5)6)24-18(26-19)23-16-9-10-20-13-22-16/h9-10,13-15H,7-8,11-12H2,1-6H3,(H2,20,21,22,23,24,25,26) |
| InChIKey | SLCDHZZJWMONRB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |