C14H20N8 — CID 117084981
4-N-cyclopropyl-2-N,2-N-diethyl-6-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 117084981) has the molecular formula C14H20N8 and a molecular weight of 300.37 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N,2-N-diethyl-6-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-cyclopropyl-2-N,2-N-diethyl-6-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117084981 |
| Molecular Formula | C14H20N8 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-N-cyclopropyl-2-N,2-N-diethyl-6-N-pyrimidin-4-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(Nc2ccncn2)nc(NC2CC2)n1 |
| InChI | InChI=1S/C14H20N8/c1-3-22(4-2)14-20-12(17-10-5-6-10)19-13(21-14)18-11-7-8-15-9-16-11/h7-10H,3-6H2,1-2H3,(H2,15,16,17,18,19,20,21) |
| InChIKey | JRVXZRPZOUODKI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |