C23H37N9 — CID 117081850
6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-(1-methylbenzimidazol-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 117081850) has the molecular formula C23H37N9 and a molecular weight of 439.61 g/mol. Its IUPAC name is 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-(1-methylbenzimidazol-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-(1-methylbenzimidazol-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117081850 |
| Molecular Formula | C23H37N9 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N,2-N-diethyl-4-N-(1-methylbenzimidazol-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCCN(C(C)C)C(C)C)nc(Nc2nc3ccccc3n2C)n1 |
| InChI | InChI=1S/C23H37N9/c1-8-31(9-2)23-27-20(24-14-15-32(16(3)4)17(5)6)26-21(29-23)28-22-25-18-12-10-11-13-19(18)30(22)7/h10-13,16-17H,8-9,14-15H2,1-7H3,(H2,24,25,26,27,28,29) |
| InChIKey | LRDMIDBGSSYGSG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |