C29H36N6O5 — CID 117092391
N-(4-morpholin-4-ylphenyl)-1-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 117092391) has the molecular formula C29H36N6O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-1-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-1-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 117092391 |
| Molecular Formula | C29H36N6O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-1-[6-(3,4,5-trimethoxyanilino)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | COc1cc(Nc2ccc(N3CCC(C(=O)Nc4ccc(N5CCOCC5)cc4)CC3)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C29H36N6O5/c1-37-24-18-22(19-25(38-2)28(24)39-3)30-26-8-9-27(33-32-26)35-12-10-20(11-13-35)29(36)31-21-4-6-23(7-5-21)34-14-16-40-17-15-34/h4-9,18-20H,10-17H2,1-3H3,(H,30,32)(H,31,36) |
| InChIKey | JYTZXWXVEGSEEM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|