C17H30O2Si2 — CID 11709573
(3R)-3-methoxy-3-(2-triethylsilylethynyl)-5-trimethylsilylpent-4-yn-2-one (PubChem CID 11709573) has the molecular formula C17H30O2Si2 and a molecular weight of 322.60 g/mol. Its IUPAC name is (3R)-3-methoxy-3-(2-triethylsilylethynyl)-5-trimethylsilylpent-4-yn-2-one.
| Compound Name | (3R)-3-methoxy-3-(2-triethylsilylethynyl)-5-trimethylsilylpent-4-yn-2-one |
|---|---|
| PubChem CID | 11709573 |
| Molecular Formula | C17H30O2Si2 |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3R)-3-methoxy-3-(2-triethylsilylethynyl)-5-trimethylsilylpent-4-yn-2-one |
| SMILES | CC[Si](C#C[C@@](C#C[Si](C)(C)C)(OC)C(C)=O)(CC)CC |
| InChI | InChI=1S/C17H30O2Si2/c1-9-21(10-2,11-3)15-13-17(19-5,16(4)18)12-14-20(6,7)8/h9-11H2,1-8H3/t17-/m1/s1 |
| InChIKey | YBLSWKYLWKUSOJ-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|