C12H18O2 — CID 117113905
4-(2-hydroxypropan-2-yl)-2,3,6-trimethylphenol (PubChem CID 117113905) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-(2-hydroxypropan-2-yl)-2,3,6-trimethylphenol.
| Compound Name | 4-(2-hydroxypropan-2-yl)-2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 117113905 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-(2-hydroxypropan-2-yl)-2,3,6-trimethylphenol |
| SMILES | Cc1cc(C(C)(C)O)c(C)c(C)c1O |
| InChI | InChI=1S/C12H18O2/c1-7-6-10(12(4,5)14)8(2)9(3)11(7)13/h6,13-14H,1-5H3 |
| InChIKey | LKQTYMVWKPPLMF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |